C24H16N2O4S2 — CID 102018707
(Z)-2-[4-[(Z)-1-cyano-2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)ethenyl]phenyl]-3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)prop-2-enenitrile (PubChem CID 102018707) has the molecular formula C24H16N2O4S2 and a molecular weight of 460.54 g/mol. Its IUPAC name is (Z)-2-[4-[(Z)-1-cyano-2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)ethenyl]phenyl]-3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-[(Z)-1-cyano-2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)ethenyl]phenyl]-3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 102018707 |
| Molecular Formula | C24H16N2O4S2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | (Z)-2-[4-[(Z)-1-cyano-2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)ethenyl]phenyl]-3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1scc2c1OCCO2)c1ccc(/C(C#N)=C/c2scc3c2OCCO3)cc1 |
| InChI | InChI=1S/C24H16N2O4S2/c25-11-17(9-21-23-19(13-31-21)27-5-7-29-23)15-1-2-16(4-3-15)18(12-26)10-22-24-20(14-32-22)28-6-8-30-24/h1-4,9-10,13-14H,5-8H2/b17-9+,18-10+ |
| InChIKey | CENKXIPWMZRGCG-BEQMOXJMSA-N |
| XLogP | 5.48 |
| TPSA | 84.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|