C32H55F3OSi6 — CID 102020727
2,2,3,3,5,5,6,6,7,7,8,8-dodecamethyl-1-pentyl-4-[4-[4-(trifluoromethoxy)phenyl]phenyl]-2,3,5,6,7,8-hexasilabicyclo[2.2.2]octane (PubChem CID 102020727) has the molecular formula C32H55F3OSi6 and a molecular weight of 681.30 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6,7,7,8,8-dodecamethyl-1-pentyl-4-[4-[4-(trifluoromethoxy)phenyl]phenyl]-2,3,5,6,7,8-hexasilabicyclo[2.2.2]octane.
| Compound Name | 2,2,3,3,5,5,6,6,7,7,8,8-dodecamethyl-1-pentyl-4-[4-[4-(trifluoromethoxy)phenyl]phenyl]-2,3,5,6,7,8-hexasilabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 102020727 |
| Molecular Formula | C32H55F3OSi6 |
| Molecular Weight | 681.30 g/mol |
| Exact Mass | 680.28 |
| IUPAC Name | 2,2,3,3,5,5,6,6,7,7,8,8-dodecamethyl-1-pentyl-4-[4-[4-(trifluoromethoxy)phenyl]phenyl]-2,3,5,6,7,8-hexasilabicyclo[2.2.2]octane |
| SMILES | CCCCCC12[Si](C)(C)[Si](C)(C)C(c3ccc(-c4ccc(OC(F)(F)F)cc4)cc3)([Si](C)(C)[Si]1(C)C)[Si](C)(C)[Si]2(C)C |
| InChI | InChI=1S/C32H55F3OSi6/c1-14-15-16-25-30-37(2,3)40(8,9)31(41(10,11)38(30,4)5,42(12,13)39(30,6)7)28-21-17-26(18-22-28)27-19-23-29(24-20-27)36-32(33,34)35/h17-24H,14-16,25H2,1-13H3 |
| InChIKey | MMZKPCSSWIKDAW-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.30 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|