C21H28O3 — CID 102024978
[(1S,5S,7aS)-5-(4-methoxyphenyl)-5,7,7-trimethyl-2,4,6,7a-tetrahydro-1H-inden-1-yl] acetate (PubChem CID 102024978) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is [(1S,5S,7aS)-5-(4-methoxyphenyl)-5,7,7-trimethyl-2,4,6,7a-tetrahydro-1H-inden-1-yl] acetate.
| Compound Name | [(1S,5S,7aS)-5-(4-methoxyphenyl)-5,7,7-trimethyl-2,4,6,7a-tetrahydro-1H-inden-1-yl] acetate |
|---|---|
| PubChem CID | 102024978 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | [(1S,5S,7aS)-5-(4-methoxyphenyl)-5,7,7-trimethyl-2,4,6,7a-tetrahydro-1H-inden-1-yl] acetate |
| SMILES | COc1ccc([C@]2(C)CC3=CC[C@H](OC(C)=O)[C@H]3C(C)(C)C2)cc1 |
| InChI | InChI=1S/C21H28O3/c1-14(22)24-18-11-6-15-12-21(4,13-20(2,3)19(15)18)16-7-9-17(23-5)10-8-16/h6-10,18-19H,11-13H2,1-5H3/t18-,19-,21+/m0/s1 |
| InChIKey | XHFLLYRVVVSTQW-IRFCIJBXSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|