C34H34S3 — CID 102026746
[3-[4-[2-[4-(2-cyclopenta-2,4-dien-1-ylethynyl)phenyl]ethynyl]phenyl]-5,7-bis(sulfanylmethyl)-1-adamantyl]methanethiol (PubChem CID 102026746) has the molecular formula C34H34S3 and a molecular weight of 538.85 g/mol. Its IUPAC name is [3-[4-[2-[4-(2-cyclopenta-2,4-dien-1-ylethynyl)phenyl]ethynyl]phenyl]-5,7-bis(sulfanylmethyl)-1-adamantyl]methanethiol.
| Compound Name | [3-[4-[2-[4-(2-cyclopenta-2,4-dien-1-ylethynyl)phenyl]ethynyl]phenyl]-5,7-bis(sulfanylmethyl)-1-adamantyl]methanethiol |
|---|---|
| PubChem CID | 102026746 |
| Molecular Formula | C34H34S3 |
| Molecular Weight | 538.85 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | [3-[4-[2-[4-(2-cyclopenta-2,4-dien-1-ylethynyl)phenyl]ethynyl]phenyl]-5,7-bis(sulfanylmethyl)-1-adamantyl]methanethiol |
| SMILES | SCC12CC3(CS)CC(CS)(C1)CC(c1ccc(C#Cc4ccc(C#CC5C=CC=C5)cc4)cc1)(C2)C3 |
| InChI | InChI=1S/C34H34S3/c35-23-31-17-32(24-36)19-33(18-31,25-37)22-34(20-31,21-32)30-15-13-29(14-16-30)12-11-28-9-7-27(8-10-28)6-5-26-3-1-2-4-26/h1-4,7-10,13-16,26,35-37H,17-25H2 |
| InChIKey | DXSQKCAYUGEANJ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.85 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|