C34H50O8Si — CID 102030320
(E,4R,5R,11S)-11-acetyloxy-5-[tert-butyl(diphenyl)silyl]oxy-4-(2-methoxyethoxymethoxy)dodec-2-enoic acid (PubChem CID 102030320) has the molecular formula C34H50O8Si and a molecular weight of 614.85 g/mol. Its IUPAC name is (E,4R,5R,11S)-11-acetyloxy-5-[tert-butyl(diphenyl)silyl]oxy-4-(2-methoxyethoxymethoxy)dodec-2-enoic acid.
| Compound Name | (E,4R,5R,11S)-11-acetyloxy-5-[tert-butyl(diphenyl)silyl]oxy-4-(2-methoxyethoxymethoxy)dodec-2-enoic acid |
|---|---|
| PubChem CID | 102030320 |
| Molecular Formula | C34H50O8Si |
| Molecular Weight | 614.85 g/mol |
| Exact Mass | 614.33 |
| IUPAC Name | (E,4R,5R,11S)-11-acetyloxy-5-[tert-butyl(diphenyl)silyl]oxy-4-(2-methoxyethoxymethoxy)dodec-2-enoic acid |
| SMILES | COCCOCO[C@H](/C=C/C(=O)O)[C@@H](CCCCC[C@H](C)OC(C)=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H50O8Si/c1-27(41-28(2)35)16-10-7-15-21-32(31(22-23-33(36)37)40-26-39-25-24-38-6)42-43(34(3,4)5,29-17-11-8-12-18-29)30-19-13-9-14-20-30/h8-9,11-14,17-20,22-23,27,31-32H,7,10,15-16,21,24-26H2,1-6H3,(H,36,37)/b23-22+/t27-,31+,32+/m0/s1 |
| InChIKey | LFKRVKOLAHGAIT-CUSDCKOXSA-N |
| XLogP | 5.48 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.85 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|