C34H46O9 — CID 102030358
3-O-[3-[4-[(E)-3-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]prop-2-enoyl]phenoxy]propyl] 1-O-methyl propanedioate (PubChem CID 102030358) has the molecular formula C34H46O9 and a molecular weight of 598.73 g/mol. Its IUPAC name is 3-O-[3-[4-[(E)-3-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]prop-2-enoyl]phenoxy]propyl] 1-O-methyl propanedioate.
| Compound Name | 3-O-[3-[4-[(E)-3-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]prop-2-enoyl]phenoxy]propyl] 1-O-methyl propanedioate |
|---|---|
| PubChem CID | 102030358 |
| Molecular Formula | C34H46O9 |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.31 |
| IUPAC Name | 3-O-[3-[4-[(E)-3-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]prop-2-enoyl]phenoxy]propyl] 1-O-methyl propanedioate |
| SMILES | COCCOCOc1c(C(C)(C)C)cc(/C=C/C(=O)c2ccc(OCCCOC(=O)CC(=O)OC)cc2)cc1C(C)(C)C |
| InChI | InChI=1S/C34H46O9/c1-33(2,3)27-20-24(21-28(34(4,5)6)32(27)43-23-40-19-18-38-7)10-15-29(35)25-11-13-26(14-12-25)41-16-9-17-42-31(37)22-30(36)39-8/h10-15,20-21H,9,16-19,22-23H2,1-8H3/b15-10+ |
| InChIKey | JUDNXADWEITYFE-XNTDXEJSSA-N |
| XLogP | 6.05 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|