C16H20N+ — CID 102041798
[(E)-1,3-di(cyclopenta-2,4-dien-1-yl)but-2-enylidene]-dimethylazanium (PubChem CID 102041798) has the molecular formula C16H20N+ and a molecular weight of 226.34 g/mol. Its IUPAC name is [(E)-1,3-di(cyclopenta-2,4-dien-1-yl)but-2-enylidene]-dimethylazanium.
| Compound Name | [(E)-1,3-di(cyclopenta-2,4-dien-1-yl)but-2-enylidene]-dimethylazanium |
|---|---|
| PubChem CID | 102041798 |
| Molecular Formula | C16H20N+ |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | [(E)-1,3-di(cyclopenta-2,4-dien-1-yl)but-2-enylidene]-dimethylazanium |
| SMILES | C/C(=C\C(C1C=CC=C1)=[N+](C)C)C1C=CC=C1 |
| InChI | InChI=1S/C16H20N/c1-13(14-8-4-5-9-14)12-16(17(2)3)15-10-6-7-11-15/h4-12,14-15H,1-3H3/q+1/b13-12+ |
| InChIKey | JCAGZMJEUMSTGN-OUKQBFOZSA-N |
| XLogP | 3.13 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|