C29H24N2O2 — CID 102043603
N-[(Z)-benzylideneamino]-N-(3-oxo-2,3-diphenylpropyl)benzamide (PubChem CID 102043603) has the molecular formula C29H24N2O2 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[(Z)-benzylideneamino]-N-(3-oxo-2,3-diphenylpropyl)benzamide.
| Compound Name | N-[(Z)-benzylideneamino]-N-(3-oxo-2,3-diphenylpropyl)benzamide |
|---|---|
| PubChem CID | 102043603 |
| Molecular Formula | C29H24N2O2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-[(Z)-benzylideneamino]-N-(3-oxo-2,3-diphenylpropyl)benzamide |
| SMILES | O=C(c1ccccc1)C(CN(/N=C\c1ccccc1)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H24N2O2/c32-28(25-17-9-3-10-18-25)27(24-15-7-2-8-16-24)22-31(29(33)26-19-11-4-12-20-26)30-21-23-13-5-1-6-14-23/h1-21,27H,22H2/b30-21- |
| InChIKey | IYUWRNMYZZZBIW-OFWBYEQRSA-N |
| XLogP | 5.83 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|