C26H26NO3PS — CID 102044493
ethyl 2-[(2S,3R)-3-(diphenylphosphinothioylamino)-3-methyl-2H-1-benzofuran-2-yl]prop-2-enoate (PubChem CID 102044493) has the molecular formula C26H26NO3PS and a molecular weight of 463.54 g/mol. Its IUPAC name is ethyl 2-[(2S,3R)-3-(diphenylphosphinothioylamino)-3-methyl-2H-1-benzofuran-2-yl]prop-2-enoate.
| Compound Name | ethyl 2-[(2S,3R)-3-(diphenylphosphinothioylamino)-3-methyl-2H-1-benzofuran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102044493 |
| Molecular Formula | C26H26NO3PS |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | ethyl 2-[(2S,3R)-3-(diphenylphosphinothioylamino)-3-methyl-2H-1-benzofuran-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@@H]1Oc2ccccc2[C@@]1(C)NP(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26NO3PS/c1-4-29-25(28)19(2)24-26(3,22-17-11-12-18-23(22)30-24)27-31(32,20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-18,24H,2,4H2,1,3H3,(H,27,32)/t24-,26+/m0/s1 |
| InChIKey | HWPPSNRDWDKADG-AZGAKELHSA-N |
| XLogP | 4.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|