C11H19NO — CID 102051680
(3R,6aR)-3-tert-butyl-1-methyl-3,5,6,6a-tetrahydrocyclopenta[c][1,2]oxazole (PubChem CID 102051680) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (3R,6aR)-3-tert-butyl-1-methyl-3,5,6,6a-tetrahydrocyclopenta[c][1,2]oxazole.
| Compound Name | (3R,6aR)-3-tert-butyl-1-methyl-3,5,6,6a-tetrahydrocyclopenta[c][1,2]oxazole |
|---|---|
| PubChem CID | 102051680 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (3R,6aR)-3-tert-butyl-1-methyl-3,5,6,6a-tetrahydrocyclopenta[c][1,2]oxazole |
| SMILES | CN1O[C@H](C(C)(C)C)C2=CCC[C@H]21 |
| InChI | InChI=1S/C11H19NO/c1-11(2,3)10-8-6-5-7-9(8)12(4)13-10/h6,9-10H,5,7H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | CAIMDZPDQFSWGO-ZJUUUORDSA-N |
| XLogP | 2.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|