C10H18NO4S+2 — CID 102055976
CID 102055976 (PubChem CID 102055976) has the molecular formula C10H18NO4S+2 and a molecular weight of 248.32 g/mol.
| Compound Name | CID 102055976 |
|---|---|
| PubChem CID | 102055976 |
| Molecular Formula | C10H18NO4S+2 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | — |
| SMILES | CC1(C)[C@H]2CC[C@]1(C[S+]([O])(=O)O[NH3+])C(=O)C2 |
| InChI | InChI=1S/C10H18NO4S/c1-9(2)7-3-4-10(9,8(12)5-7)6-16(13,14)15-11/h7H,3-6H2,1-2,11H3/q+2/t7-,10-/m0/s1 |
| InChIKey | RRLJNPWRNYYUFK-XVKPBYJWSA-N |
| XLogP | 0.32 |
| TPSA | 90.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|