C13H22N2S — CID 102058374
1,1-dimethyl-3-[(1R,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl]thiourea (PubChem CID 102058374) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(1R,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl]thiourea.
| Compound Name | 1,1-dimethyl-3-[(1R,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl]thiourea |
|---|---|
| PubChem CID | 102058374 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1,1-dimethyl-3-[(1R,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl]thiourea |
| SMILES | CN(C)C(=S)N[C@@H]1C[C@H]2C[C@@H]1C1CCCC12 |
| InChI | InChI=1S/C13H22N2S/c1-15(2)13(16)14-12-7-8-6-11(12)10-5-3-4-9(8)10/h8-12H,3-7H2,1-2H3,(H,14,16)/t8-,9?,10?,11-,12-/m1/s1 |
| InChIKey | HNKLSLNEIRIASJ-URVOOWSZSA-N |
| XLogP | 2.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|