C20H24N2O3 — CID 102061898
methyl (E)-3-[(2R,6R)-3-[2-(1H-indol-3-yl)ethyl]-2,6-dimethyl-2,6-dihydro-1,3-oxazin-5-yl]prop-2-enoate (PubChem CID 102061898) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl (E)-3-[(2R,6R)-3-[2-(1H-indol-3-yl)ethyl]-2,6-dimethyl-2,6-dihydro-1,3-oxazin-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2R,6R)-3-[2-(1H-indol-3-yl)ethyl]-2,6-dimethyl-2,6-dihydro-1,3-oxazin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102061898 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | methyl (E)-3-[(2R,6R)-3-[2-(1H-indol-3-yl)ethyl]-2,6-dimethyl-2,6-dihydro-1,3-oxazin-5-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/C1=CN(CCc2c[nH]c3ccccc23)[C@@H](C)O[C@@H]1C |
| InChI | InChI=1S/C20H24N2O3/c1-14-17(8-9-20(23)24-3)13-22(15(2)25-14)11-10-16-12-21-19-7-5-4-6-18(16)19/h4-9,12-15,21H,10-11H2,1-3H3/b9-8+/t14-,15-/m1/s1 |
| InChIKey | LUAQAGIYJNULKS-VMFRVMOISA-N |
| XLogP | 3.39 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|