C22H22N2O4 — CID 13167694
methyl (E)-3-[(6E)-1-[2-(1H-indol-3-yl)ethyl]-6-(2-methoxy-2-oxoethylidene)-3-pyridinyl]prop-2-enoate (PubChem CID 13167694) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is methyl (E)-3-[(6E)-1-[2-(1H-indol-3-yl)ethyl]-6-(2-methoxy-2-oxoethylidene)-3-pyridinyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(6E)-1-[2-(1H-indol-3-yl)ethyl]-6-(2-methoxy-2-oxoethylidene)-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 13167694 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | methyl (E)-3-[(6E)-1-[2-(1H-indol-3-yl)ethyl]-6-(2-methoxy-2-oxoethylidene)-3-pyridinyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/C1=CN(CCc2c[nH]c3ccccc23)/C(=C/C(=O)OC)C=C1 |
| InChI | InChI=1S/C22H22N2O4/c1-27-21(25)10-8-16-7-9-18(13-22(26)28-2)24(15-16)12-11-17-14-23-20-6-4-3-5-19(17)20/h3-10,13-15,23H,11-12H2,1-2H3/b10-8+,18-13+ |
| InChIKey | AOGGUXBKIFIMOB-ZCQNHDJMSA-N |
| XLogP | 3.25 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|