C18H32OSi2 — CID 102064395
1,1,3,3-tetra(propan-2-yl)-2,1,3-benzoxadisilole (PubChem CID 102064395) has the molecular formula C18H32OSi2 and a molecular weight of 320.63 g/mol. Its IUPAC name is 1,1,3,3-tetra(propan-2-yl)-2,1,3-benzoxadisilole.
| Compound Name | 1,1,3,3-tetra(propan-2-yl)-2,1,3-benzoxadisilole |
|---|---|
| PubChem CID | 102064395 |
| Molecular Formula | C18H32OSi2 |
| Molecular Weight | 320.63 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1,1,3,3-tetra(propan-2-yl)-2,1,3-benzoxadisilole |
| SMILES | CC(C)[Si]1(C(C)C)O[Si](C(C)C)(C(C)C)c2ccccc21 |
| InChI | InChI=1S/C18H32OSi2/c1-13(2)20(14(3)4)17-11-9-10-12-18(17)21(19-20,15(5)6)16(7)8/h9-16H,1-8H3 |
| InChIKey | LVMVFBGLAQXJPU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|