C18H24Si2 — CID 171436292
5,5,10-trimethyl-10-propan-2-ylsilanthrene (PubChem CID 171436292) has the molecular formula C18H24Si2 and a molecular weight of 296.56 g/mol. Its IUPAC name is 5,5,10-trimethyl-10-propan-2-ylsilanthrene.
| Compound Name | 5,5,10-trimethyl-10-propan-2-ylsilanthrene |
|---|---|
| PubChem CID | 171436292 |
| Molecular Formula | C18H24Si2 |
| Molecular Weight | 296.56 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 5,5,10-trimethyl-10-propan-2-ylsilanthrene |
| SMILES | CC(C)[Si]1(C)c2ccccc2[Si](C)(C)c2ccccc21 |
| InChI | InChI=1S/C18H24Si2/c1-14(2)20(5)17-12-8-6-10-15(17)19(3,4)16-11-7-9-13-18(16)20/h6-14H,1-5H3 |
| InChIKey | SYAJIZAWHJZSKQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.56 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|