C30H52Si4 — CID 102485704
(5S,8R,13R,14S)-5,8,13,14-tetramethyl-5,8,13,14-tetra(propan-2-yl)-6,7-dihydrobenzo[c][1,2,5,8]benzotetrasilecine (PubChem CID 102485704) has the molecular formula C30H52Si4 and a molecular weight of 525.09 g/mol. Its IUPAC name is (5S,8R,13R,14S)-5,8,13,14-tetramethyl-5,8,13,14-tetra(propan-2-yl)-6,7-dihydrobenzo[c][1,2,5,8]benzotetrasilecine.
| Compound Name | (5S,8R,13R,14S)-5,8,13,14-tetramethyl-5,8,13,14-tetra(propan-2-yl)-6,7-dihydrobenzo[c][1,2,5,8]benzotetrasilecine |
|---|---|
| PubChem CID | 102485704 |
| Molecular Formula | C30H52Si4 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | (5S,8R,13R,14S)-5,8,13,14-tetramethyl-5,8,13,14-tetra(propan-2-yl)-6,7-dihydrobenzo[c][1,2,5,8]benzotetrasilecine |
| SMILES | CC(C)[Si@@]1(C)CC[Si@@](C)(C(C)C)c2ccccc2[Si@](C)(C(C)C)[Si@](C)(C(C)C)c2ccccc21 |
| InChI | InChI=1S/C30H52Si4/c1-23(2)31(9)21-22-32(10,24(3)4)28-18-14-16-20-30(28)34(12,26(7)8)33(11,25(5)6)29-19-15-13-17-27(29)31/h13-20,23-26H,21-22H2,1-12H3/t31-,32+,33-,34+ |
| InChIKey | RWWYKAZDQUMOMB-WKKVWOBLSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|