C22H35NOSi — CID 167654242
ethane;10-hydroxy-10-methyl-5-propan-2-ylbenzo[b][1,4]benzazasiline;2-methylpropane (PubChem CID 167654242) has the molecular formula C22H35NOSi and a molecular weight of 357.61 g/mol. Its IUPAC name is ethane;10-hydroxy-10-methyl-5-propan-2-ylbenzo[b][1,4]benzazasiline;2-methylpropane.
| Compound Name | ethane;10-hydroxy-10-methyl-5-propan-2-ylbenzo[b][1,4]benzazasiline;2-methylpropane |
|---|---|
| PubChem CID | 167654242 |
| Molecular Formula | C22H35NOSi |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | ethane;10-hydroxy-10-methyl-5-propan-2-ylbenzo[b][1,4]benzazasiline;2-methylpropane |
| SMILES | CC.CC(C)C.CC(C)N1c2ccccc2[Si](C)(O)c2ccccc21 |
| InChI | InChI=1S/C16H19NOSi.C4H10.C2H6/c1-12(2)17-13-8-4-6-10-15(13)19(3,18)16-11-7-5-9-14(16)17;1-4(2)3;1-2/h4-12,18H,1-3H3;4H,1-3H3;1-2H3 |
| InChIKey | RAFHLODUUHMOER-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|