C30H52O8Si6 — CID 102351920
5,11-diphenyl-1,3,5,7,9,11-hexa(propan-2-yl)-2,4,6,8,10,12,13,14-octaoxa-1,3,5,7,9,11-hexasilatricyclo[7.3.1.13,7]tetradecane (PubChem CID 102351920) has the molecular formula C30H52O8Si6 and a molecular weight of 709.25 g/mol. Its IUPAC name is 5,11-diphenyl-1,3,5,7,9,11-hexa(propan-2-yl)-2,4,6,8,10,12,13,14-octaoxa-1,3,5,7,9,11-hexasilatricyclo[7.3.1.13,7]tetradecane.
| Compound Name | 5,11-diphenyl-1,3,5,7,9,11-hexa(propan-2-yl)-2,4,6,8,10,12,13,14-octaoxa-1,3,5,7,9,11-hexasilatricyclo[7.3.1.13,7]tetradecane |
|---|---|
| PubChem CID | 102351920 |
| Molecular Formula | C30H52O8Si6 |
| Molecular Weight | 709.25 g/mol |
| Exact Mass | 708.23 |
| IUPAC Name | 5,11-diphenyl-1,3,5,7,9,11-hexa(propan-2-yl)-2,4,6,8,10,12,13,14-octaoxa-1,3,5,7,9,11-hexasilatricyclo[7.3.1.13,7]tetradecane |
| SMILES | CC(C)[Si]12O[Si](C(C)C)(O[Si]3(C(C)C)O[Si](C(C)C)(O1)O[Si](c1ccccc1)(C(C)C)O3)O[Si](c1ccccc1)(C(C)C)O2 |
| InChI | InChI=1S/C30H52O8Si6/c1-23(2)39(29-19-15-13-16-20-29)31-41(25(5)6)35-42(32-39,26(7)8)38-44(28(11)12)34-40(24(3)4,30-21-17-14-18-22-30)33-43(36-44,37-41)27(9)10/h13-28H,1-12H3 |
| InChIKey | RWODCIWFWUHBMO-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.25 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|