C24H18O3Si3 — CID 174007685
2,4,6-triethynyl-2,4,6-triphenyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 174007685) has the molecular formula C24H18O3Si3 and a molecular weight of 438.66 g/mol. Its IUPAC name is 2,4,6-triethynyl-2,4,6-triphenyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,4,6-triethynyl-2,4,6-triphenyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 174007685 |
| Molecular Formula | C24H18O3Si3 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 2,4,6-triethynyl-2,4,6-triphenyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C#C[Si]1(c2ccccc2)O[Si](C#C)(c2ccccc2)O[Si](C#C)(c2ccccc2)O1 |
| InChI | InChI=1S/C24H18O3Si3/c1-4-28(22-16-10-7-11-17-22)25-29(5-2,23-18-12-8-13-19-23)27-30(6-3,26-28)24-20-14-9-15-21-24/h1-3,7-21H |
| InChIKey | SWYJJYHMWMYMDK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|