C18H22O6 — CID 102068995
(E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhept-4-enoic acid (PubChem CID 102068995) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhept-4-enoic acid.
| Compound Name | (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhept-4-enoic acid |
|---|---|
| PubChem CID | 102068995 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhept-4-enoic acid |
| SMILES | COc1c(C)c2c(c(O)c1C(C)/C=C(\C)CCC(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C18H22O6/c1-9(5-6-13(19)20)7-10(2)14-16(21)15-12(8-24-18(15)22)11(3)17(14)23-4/h7,10,21H,5-6,8H2,1-4H3,(H,19,20)/b9-7+ |
| InChIKey | NSUJVYCNTMGUIL-VQHVLOKHSA-N |
| XLogP | 3.29 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|