C26H31N3O14S — CID 102074129
(2S,3S,4R,5R,6R)-3-[(2R,3R,4R,5R,6R)-3-azido-5-hydroxy-4-phenylmethoxy-6-(sulfooxymethyl)oxan-2-yl]oxy-4,5-dihydroxy-6-phenylmethoxyoxane-2-carboxylic acid (PubChem CID 102074129) has the molecular formula C26H31N3O14S and a molecular weight of 641.61 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-3-[(2R,3R,4R,5R,6R)-3-azido-5-hydroxy-4-phenylmethoxy-6-(sulfooxymethyl)oxan-2-yl]oxy-4,5-dihydroxy-6-phenylmethoxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R,6R)-3-[(2R,3R,4R,5R,6R)-3-azido-5-hydroxy-4-phenylmethoxy-6-(sulfooxymethyl)oxan-2-yl]oxy-4,5-dihydroxy-6-phenylmethoxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 102074129 |
| Molecular Formula | C26H31N3O14S |
| Molecular Weight | 641.61 g/mol |
| Exact Mass | 641.15 |
| IUPAC Name | (2S,3S,4R,5R,6R)-3-[(2R,3R,4R,5R,6R)-3-azido-5-hydroxy-4-phenylmethoxy-6-(sulfooxymethyl)oxan-2-yl]oxy-4,5-dihydroxy-6-phenylmethoxyoxane-2-carboxylic acid |
| SMILES | [N-]=[N+]=N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](OCc3ccccc3)O[C@@H]2C(=O)O)O[C@H](COS(=O)(=O)O)[C@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H31N3O14S/c27-29-28-17-21(38-11-14-7-3-1-4-8-14)18(30)16(13-40-44(35,36)37)41-25(17)42-22-19(31)20(32)26(43-23(22)24(33)34)39-12-15-9-5-2-6-10-15/h1-10,16-23,25-26,30-32H,11-13H2,(H,33,34)(H,35,36,37)/t16-,17-,18+,19-,20-,21-,22+,23+,25-,26-/m1/s1 |
| InChIKey | FMCOFJVJGZDQEN-HNRLRVFFSA-N |
| XLogP | 0.29 |
| TPSA | 256.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.61 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|