C22H30N2O2 — CID 102079374
6-benzyl-3-methylidene-7-oxo-N,N-di(propan-2-yl)-6-azabicyclo[3.2.1]octane-5-carboxamide (PubChem CID 102079374) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 6-benzyl-3-methylidene-7-oxo-N,N-di(propan-2-yl)-6-azabicyclo[3.2.1]octane-5-carboxamide.
| Compound Name | 6-benzyl-3-methylidene-7-oxo-N,N-di(propan-2-yl)-6-azabicyclo[3.2.1]octane-5-carboxamide |
|---|---|
| PubChem CID | 102079374 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 6-benzyl-3-methylidene-7-oxo-N,N-di(propan-2-yl)-6-azabicyclo[3.2.1]octane-5-carboxamide |
| SMILES | C=C1CC2CC(C(=O)N(C(C)C)C(C)C)(C1)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C22H30N2O2/c1-15(2)24(16(3)4)21(26)22-12-17(5)11-19(13-22)20(25)23(22)14-18-9-7-6-8-10-18/h6-10,15-16,19H,5,11-14H2,1-4H3 |
| InChIKey | JCBZJWPLNMNGBE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|