C42H55NO5Si2 — CID 102079994
2-hydroxy-4,9-bis[2-tri(propan-2-yl)silyloxyphenyl]benzo[f]isoindole-1,3-dione (PubChem CID 102079994) has the molecular formula C42H55NO5Si2 and a molecular weight of 710.08 g/mol. Its IUPAC name is 2-hydroxy-4,9-bis[2-tri(propan-2-yl)silyloxyphenyl]benzo[f]isoindole-1,3-dione.
| Compound Name | 2-hydroxy-4,9-bis[2-tri(propan-2-yl)silyloxyphenyl]benzo[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102079994 |
| Molecular Formula | C42H55NO5Si2 |
| Molecular Weight | 710.08 g/mol |
| Exact Mass | 709.36 |
| IUPAC Name | 2-hydroxy-4,9-bis[2-tri(propan-2-yl)silyloxyphenyl]benzo[f]isoindole-1,3-dione |
| SMILES | CC(C)[Si](Oc1ccccc1-c1c2c(c(-c3ccccc3O[Si](C(C)C)(C(C)C)C(C)C)c3ccccc13)C(=O)N(O)C2=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C42H55NO5Si2/c1-25(2)49(26(3)4,27(5)6)47-35-23-17-15-21-33(35)37-31-19-13-14-20-32(31)38(40-39(37)41(44)43(46)42(40)45)34-22-16-18-24-36(34)48-50(28(7)8,29(9)10)30(11)12/h13-30,46H,1-12H3 |
| InChIKey | SYSXUHLCLKDEMQ-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.08 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|