C16H21ClO6 — CID 102084860
[(2R,3R,4R,5S,6S)-5-hydroxy-2-methoxy-6-methyl-4-phenylmethoxyoxan-3-yl] 2-chloroacetate (PubChem CID 102084860) has the molecular formula C16H21ClO6 and a molecular weight of 344.79 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-5-hydroxy-2-methoxy-6-methyl-4-phenylmethoxyoxan-3-yl] 2-chloroacetate.
| Compound Name | [(2R,3R,4R,5S,6S)-5-hydroxy-2-methoxy-6-methyl-4-phenylmethoxyoxan-3-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 102084860 |
| Molecular Formula | C16H21ClO6 |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-5-hydroxy-2-methoxy-6-methyl-4-phenylmethoxyoxan-3-yl] 2-chloroacetate |
| SMILES | CO[C@@H]1O[C@@H](C)[C@H](O)[C@@H](OCc2ccccc2)[C@H]1OC(=O)CCl |
| InChI | InChI=1S/C16H21ClO6/c1-10-13(19)14(21-9-11-6-4-3-5-7-11)15(16(20-2)22-10)23-12(18)8-17/h3-7,10,13-16,19H,8-9H2,1-2H3/t10-,13-,14+,15+,16+/m0/s1 |
| InChIKey | ZCMZFHHAAFDDHW-BVEJOUGXSA-N |
| XLogP | 1.47 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|