C27H26N4O5 — CID 102090066
N-[(1R,2R)-3-amino-2-benzamido-3-oxo-1-phenylpropyl]-3,4,5-trimethoxybenzenecarboximidoyl cyanide (PubChem CID 102090066) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is N-[(1R,2R)-3-amino-2-benzamido-3-oxo-1-phenylpropyl]-3,4,5-trimethoxybenzenecarboximidoyl cyanide.
| Compound Name | N-[(1R,2R)-3-amino-2-benzamido-3-oxo-1-phenylpropyl]-3,4,5-trimethoxybenzenecarboximidoyl cyanide |
|---|---|
| PubChem CID | 102090066 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-[(1R,2R)-3-amino-2-benzamido-3-oxo-1-phenylpropyl]-3,4,5-trimethoxybenzenecarboximidoyl cyanide |
| SMILES | COc1cc(/C(C#N)=N/[C@H](c2ccccc2)[C@@H](NC(=O)c2ccccc2)C(N)=O)cc(OC)c1OC |
| InChI | InChI=1S/C27H26N4O5/c1-34-21-14-19(15-22(35-2)25(21)36-3)20(16-28)30-23(17-10-6-4-7-11-17)24(26(29)32)31-27(33)18-12-8-5-9-13-18/h4-15,23-24H,1-3H3,(H2,29,32)(H,31,33)/b30-20+/t23-,24-/m1/s1 |
| InChIKey | KVHJJVPYNGSRIF-CPQPWYGLSA-N |
| XLogP | 3.05 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|