C20H11F16N — CID 102097067
2-[2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-5-(trifluoromethyl)phenyl]pyridine (PubChem CID 102097067) has the molecular formula C20H11F16N and a molecular weight of 569.28 g/mol. Its IUPAC name is 2-[2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-5-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 2-[2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-5-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 102097067 |
| Molecular Formula | C20H11F16N |
| Molecular Weight | 569.28 g/mol |
| Exact Mass | 569.06 |
| IUPAC Name | 2-[2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-5-(trifluoromethyl)phenyl]pyridine |
| SMILES | FC(F)(F)c1ccc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(-c2ccccn2)c1 |
| InChI | InChI=1S/C20H11F16N/c21-14(22,16(26,27)17(28,29)18(30,31)19(32,33)20(34,35)36)7-6-10-4-5-11(15(23,24)25)9-12(10)13-3-1-2-8-37-13/h1-5,8-9H,6-7H2 |
| InChIKey | NRMTVRWZRADQEW-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.28 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|