C22H33BrO3SSi — CID 102097847
3-[4-(5-bromothiophen-2-yl)phenyl]propyl-tri(propan-2-yloxy)silane (PubChem CID 102097847) has the molecular formula C22H33BrO3SSi and a molecular weight of 485.56 g/mol. Its IUPAC name is 3-[4-(5-bromothiophen-2-yl)phenyl]propyl-tri(propan-2-yloxy)silane.
| Compound Name | 3-[4-(5-bromothiophen-2-yl)phenyl]propyl-tri(propan-2-yloxy)silane |
|---|---|
| PubChem CID | 102097847 |
| Molecular Formula | C22H33BrO3SSi |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 3-[4-(5-bromothiophen-2-yl)phenyl]propyl-tri(propan-2-yloxy)silane |
| SMILES | CC(C)O[Si](CCCc1ccc(-c2ccc(Br)s2)cc1)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C22H33BrO3SSi/c1-16(2)24-28(25-17(3)4,26-18(5)6)15-7-8-19-9-11-20(12-10-19)21-13-14-22(23)27-21/h9-14,16-18H,7-8,15H2,1-6H3 |
| InChIKey | FYNFNFBEPPORQH-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|