C11H20N2O — CID 102105006
N-[4-(2,3,4,5-tetrahydropyridin-6-yl)butyl]acetamide (PubChem CID 102105006) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N-[4-(2,3,4,5-tetrahydropyridin-6-yl)butyl]acetamide.
| Compound Name | N-[4-(2,3,4,5-tetrahydropyridin-6-yl)butyl]acetamide |
|---|---|
| PubChem CID | 102105006 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N-[4-(2,3,4,5-tetrahydropyridin-6-yl)butyl]acetamide |
| SMILES | CC(=O)NCCCCC1=NCCCC1 |
| InChI | InChI=1S/C11H20N2O/c1-10(14)12-8-4-2-6-11-7-3-5-9-13-11/h2-9H2,1H3,(H,12,14) |
| InChIKey | ZJAGXXVGOXDHTO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|