C31H49NO4Si — CID 102105820
tert-butyl 2-methoxy-10-propyl-8-tri(propan-2-yl)silyloxy-7,10-dihydro-6H-cyclohepta[b]indole-5-carboxylate (PubChem CID 102105820) has the molecular formula C31H49NO4Si and a molecular weight of 527.82 g/mol. Its IUPAC name is tert-butyl 2-methoxy-10-propyl-8-tri(propan-2-yl)silyloxy-7,10-dihydro-6H-cyclohepta[b]indole-5-carboxylate.
| Compound Name | tert-butyl 2-methoxy-10-propyl-8-tri(propan-2-yl)silyloxy-7,10-dihydro-6H-cyclohepta[b]indole-5-carboxylate |
|---|---|
| PubChem CID | 102105820 |
| Molecular Formula | C31H49NO4Si |
| Molecular Weight | 527.82 g/mol |
| Exact Mass | 527.34 |
| IUPAC Name | tert-butyl 2-methoxy-10-propyl-8-tri(propan-2-yl)silyloxy-7,10-dihydro-6H-cyclohepta[b]indole-5-carboxylate |
| SMILES | CCCC1C=C(O[Si](C(C)C)(C(C)C)C(C)C)CCc2c1c1cc(OC)ccc1n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H49NO4Si/c1-12-13-23-18-25(36-37(20(2)3,21(4)5)22(6)7)15-17-28-29(23)26-19-24(34-11)14-16-27(26)32(28)30(33)35-31(8,9)10/h14,16,18-23H,12-13,15,17H2,1-11H3 |
| InChIKey | ZNUYTFVOEANQGT-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.82 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|