C20H23ClO5 — CID 102106052
(1S,4R,5S,6S,9R,10S,11S,12S)-6-chloro-12-(furan-3-yl)-5-hydroxy-4,5,10-trimethyl-13-oxatetracyclo[8.4.0.01,11.04,9]tetradecane-2,14-dione (PubChem CID 102106052) has the molecular formula C20H23ClO5 and a molecular weight of 378.85 g/mol. Its IUPAC name is (1S,4R,5S,6S,9R,10S,11S,12S)-6-chloro-12-(furan-3-yl)-5-hydroxy-4,5,10-trimethyl-13-oxatetracyclo[8.4.0.01,11.04,9]tetradecane-2,14-dione.
| Compound Name | (1S,4R,5S,6S,9R,10S,11S,12S)-6-chloro-12-(furan-3-yl)-5-hydroxy-4,5,10-trimethyl-13-oxatetracyclo[8.4.0.01,11.04,9]tetradecane-2,14-dione |
|---|---|
| PubChem CID | 102106052 |
| Molecular Formula | C20H23ClO5 |
| Molecular Weight | 378.85 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (1S,4R,5S,6S,9R,10S,11S,12S)-6-chloro-12-(furan-3-yl)-5-hydroxy-4,5,10-trimethyl-13-oxatetracyclo[8.4.0.01,11.04,9]tetradecane-2,14-dione |
| SMILES | C[C@]12[C@@H]3[C@@H](c4ccoc4)OC(=O)[C@@]31C(=O)C[C@]1(C)[C@@H]2CC[C@H](Cl)[C@@]1(C)O |
| InChI | InChI=1S/C20H23ClO5/c1-17-8-13(22)20-15(14(26-16(20)23)10-6-7-25-9-10)18(20,2)11(17)4-5-12(21)19(17,3)24/h6-7,9,11-12,14-15,24H,4-5,8H2,1-3H3/t11-,12-,14+,15-,17+,18-,19+,20+/m0/s1 |
| InChIKey | GKJCLJMYPDMELI-VKIBTOCMSA-N |
| XLogP | 3.25 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.85 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|