C20H22O5 — CID 102106051
(1R,2S,3S,4S,7S,10R,11S,13R)-4-(furan-3-yl)-2,10,11-trimethyl-5,12-dioxapentacyclo[8.5.0.02,7.03,7.011,13]pentadecane-6,8-dione (PubChem CID 102106051) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is (1R,2S,3S,4S,7S,10R,11S,13R)-4-(furan-3-yl)-2,10,11-trimethyl-5,12-dioxapentacyclo[8.5.0.02,7.03,7.011,13]pentadecane-6,8-dione.
| Compound Name | (1R,2S,3S,4S,7S,10R,11S,13R)-4-(furan-3-yl)-2,10,11-trimethyl-5,12-dioxapentacyclo[8.5.0.02,7.03,7.011,13]pentadecane-6,8-dione |
|---|---|
| PubChem CID | 102106051 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (1R,2S,3S,4S,7S,10R,11S,13R)-4-(furan-3-yl)-2,10,11-trimethyl-5,12-dioxapentacyclo[8.5.0.02,7.03,7.011,13]pentadecane-6,8-dione |
| SMILES | C[C@]12[C@@H]3[C@@H](c4ccoc4)OC(=O)[C@@]31C(=O)C[C@]1(C)[C@@H]2CC[C@H]2O[C@]21C |
| InChI | InChI=1S/C20H22O5/c1-17-8-12(21)20-15(14(24-16(20)22)10-6-7-23-9-10)18(20,2)11(17)4-5-13-19(17,3)25-13/h6-7,9,11,13-15H,4-5,8H2,1-3H3/t11-,13+,14+,15-,17+,18-,19+,20+/m0/s1 |
| InChIKey | MXCWFIORGFVJPA-VELVDXENSA-N |
| XLogP | 3.05 |
| TPSA | 69.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|