C14H18O3 — CID 102106710
(3aS,8aR,8bS)-spiro[1,2,3a,6,7,8,8a,8b-octahydrocyclopenta[a]indene-3,2'-1,3-dioxolane]-4-one (PubChem CID 102106710) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (3aS,8aR,8bS)-spiro[1,2,3a,6,7,8,8a,8b-octahydrocyclopenta[a]indene-3,2'-1,3-dioxolane]-4-one.
| Compound Name | (3aS,8aR,8bS)-spiro[1,2,3a,6,7,8,8a,8b-octahydrocyclopenta[a]indene-3,2'-1,3-dioxolane]-4-one |
|---|---|
| PubChem CID | 102106710 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (3aS,8aR,8bS)-spiro[1,2,3a,6,7,8,8a,8b-octahydrocyclopenta[a]indene-3,2'-1,3-dioxolane]-4-one |
| SMILES | O=C1C2=CCCC[C@@H]2[C@@H]2CCC3(OCCO3)[C@H]12 |
| InChI | InChI=1S/C14H18O3/c15-13-11-4-2-1-3-9(11)10-5-6-14(12(10)13)16-7-8-17-14/h4,9-10,12H,1-3,5-8H2/t9-,10+,12+/m1/s1 |
| InChIKey | PPLGCAZKKHEUIR-SCVCMEIPSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |