C38H46N4O7 — CID 10211896
(3S)-3-(2-methylpropyl)-1,4-bis[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazin-2-one (PubChem CID 10211896) has the molecular formula C38H46N4O7 and a molecular weight of 670.81 g/mol. Its IUPAC name is (3S)-3-(2-methylpropyl)-1,4-bis[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazin-2-one.
| Compound Name | (3S)-3-(2-methylpropyl)-1,4-bis[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 10211896 |
| Molecular Formula | C38H46N4O7 |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.34 |
| IUPAC Name | (3S)-3-(2-methylpropyl)-1,4-bis[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazin-2-one |
| SMILES | COc1cc(-c2cc(CN3CCN(Cc4ccnc(-c5cc(OC)c(OC)c(OC)c5)c4)[C@@H](CC(C)C)C3=O)ccn2)cc(OC)c1OC |
| InChI | InChI=1S/C38H46N4O7/c1-24(2)15-31-38(43)42(23-26-10-12-40-30(17-26)28-20-34(46-5)37(49-8)35(21-28)47-6)14-13-41(31)22-25-9-11-39-29(16-25)27-18-32(44-3)36(48-7)33(19-27)45-4/h9-12,16-21,24,31H,13-15,22-23H2,1-8H3/t31-/m0/s1 |
| InChIKey | SZYLCPQPFBZHCP-HKBQPEDESA-N |
| XLogP | 6.12 |
| TPSA | 104.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |