C24H16N4O4 — CID 102125290
(2R,6S,7R,11S)-2-(1H-indol-3-yl)-4,9,19-triazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),13,15,17-tetraene-3,5,8,10-tetrone (PubChem CID 102125290) has the molecular formula C24H16N4O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is (2R,6S,7R,11S)-2-(1H-indol-3-yl)-4,9,19-triazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),13,15,17-tetraene-3,5,8,10-tetrone.
| Compound Name | (2R,6S,7R,11S)-2-(1H-indol-3-yl)-4,9,19-triazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),13,15,17-tetraene-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 102125290 |
| Molecular Formula | C24H16N4O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | (2R,6S,7R,11S)-2-(1H-indol-3-yl)-4,9,19-triazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),13,15,17-tetraene-3,5,8,10-tetrone |
| SMILES | O=C1NC(=O)[C@@H]2c3c([nH]c4ccccc34)[C@@]3(c4c[nH]c5ccccc45)C(=O)NC(=O)[C@H]3[C@H]12 |
| InChI | InChI=1S/C24H16N4O4/c29-20-16-15-11-6-2-4-8-14(11)26-19(15)24(12-9-25-13-7-3-1-5-10(12)13)18(17(16)21(30)27-20)22(31)28-23(24)32/h1-9,16-18,25-26H,(H,27,29,30)(H,28,31,32)/t16-,17-,18-,24+/m1/s1 |
| InChIKey | ZGTNSUPREAXUQT-RTPKDJLFSA-N |
| XLogP | 1.58 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|