C32H50O3SSi — CID 102130936
(4aS,4bS,7S,8S,8aS,10aS)-4b,8-dimethyl-10a-(phenylsulfanylmethyl)-7-tri(propan-2-yl)silyloxy-1,2,4,4a,5,6,7,8,8a,9-decahydrophenanthrene-3,10-dione (PubChem CID 102130936) has the molecular formula C32H50O3SSi and a molecular weight of 542.90 g/mol. Its IUPAC name is (4aS,4bS,7S,8S,8aS,10aS)-4b,8-dimethyl-10a-(phenylsulfanylmethyl)-7-tri(propan-2-yl)silyloxy-1,2,4,4a,5,6,7,8,8a,9-decahydrophenanthrene-3,10-dione.
| Compound Name | (4aS,4bS,7S,8S,8aS,10aS)-4b,8-dimethyl-10a-(phenylsulfanylmethyl)-7-tri(propan-2-yl)silyloxy-1,2,4,4a,5,6,7,8,8a,9-decahydrophenanthrene-3,10-dione |
|---|---|
| PubChem CID | 102130936 |
| Molecular Formula | C32H50O3SSi |
| Molecular Weight | 542.90 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | (4aS,4bS,7S,8S,8aS,10aS)-4b,8-dimethyl-10a-(phenylsulfanylmethyl)-7-tri(propan-2-yl)silyloxy-1,2,4,4a,5,6,7,8,8a,9-decahydrophenanthrene-3,10-dione |
| SMILES | CC(C)[Si](O[C@H]1CC[C@]2(C)[C@@H]3CC(=O)CC[C@@]3(CSc3ccccc3)C(=O)C[C@H]2[C@@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H50O3SSi/c1-21(2)37(22(3)4,23(5)6)35-28-15-16-31(8)27(24(28)7)19-30(34)32(17-14-25(33)18-29(31)32)20-36-26-12-10-9-11-13-26/h9-13,21-24,27-29H,14-20H2,1-8H3/t24-,27-,28-,29-,31-,32-/m0/s1 |
| InChIKey | MEPUDOMMJSXTEN-CRYRSLIFSA-N |
| XLogP | 8.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.90 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|