C27H42O2SSi — CID 15923496
(4R)-4-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-1-phenylsulfanylpentan-2-one (PubChem CID 15923496) has the molecular formula C27H42O2SSi and a molecular weight of 458.78 g/mol. Its IUPAC name is (4R)-4-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-1-phenylsulfanylpentan-2-one.
| Compound Name | (4R)-4-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-1-phenylsulfanylpentan-2-one |
|---|---|
| PubChem CID | 15923496 |
| Molecular Formula | C27H42O2SSi |
| Molecular Weight | 458.78 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | (4R)-4-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-1-phenylsulfanylpentan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)C([C@H](C)CC(=O)CSc3ccccc3)=CC[C@@H]12 |
| InChI | InChI=1S/C27H42O2SSi/c1-6-31(7-2,8-3)29-26-15-12-18-27(5)24(16-17-25(26)27)21(4)19-22(28)20-30-23-13-10-9-11-14-23/h9-11,13-14,16,21,25-26H,6-8,12,15,17-20H2,1-5H3/t21-,25+,26+,27-/m1/s1 |
| InChIKey | ODFUYXPOIRFBKW-NVSKSXHLSA-N |
| XLogP | 7.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.78 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|