C18H26O2SSi — CID 10337003
(3aS,7aR)-3-[phenylsulfanyl(trimethylsilyl)methyl]-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one (PubChem CID 10337003) has the molecular formula C18H26O2SSi and a molecular weight of 334.56 g/mol. Its IUPAC name is (3aS,7aR)-3-[phenylsulfanyl(trimethylsilyl)methyl]-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one.
| Compound Name | (3aS,7aR)-3-[phenylsulfanyl(trimethylsilyl)methyl]-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 10337003 |
| Molecular Formula | C18H26O2SSi |
| Molecular Weight | 334.56 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (3aS,7aR)-3-[phenylsulfanyl(trimethylsilyl)methyl]-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
| SMILES | C[Si](C)(C)C(Sc1ccccc1)C1C(=O)O[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C18H26O2SSi/c1-22(2,3)18(21-13-9-5-4-6-10-13)16-14-11-7-8-12-15(14)20-17(16)19/h4-6,9-10,14-16,18H,7-8,11-12H2,1-3H3/t14-,15-,16?,18?/m1/s1 |
| InChIKey | FWPAZCZRBVFEOP-RSIVFMTNSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|