C26H42OSSi — CID 71221900
[(3aR,4S,7aS)-7a-methyl-1-[(2R)-4-phenylsulfanylbutan-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane (PubChem CID 71221900) has the molecular formula C26H42OSSi and a molecular weight of 430.77 g/mol. Its IUPAC name is [(3aR,4S,7aS)-7a-methyl-1-[(2R)-4-phenylsulfanylbutan-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane.
| Compound Name | [(3aR,4S,7aS)-7a-methyl-1-[(2R)-4-phenylsulfanylbutan-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 71221900 |
| Molecular Formula | C26H42OSSi |
| Molecular Weight | 430.77 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | [(3aR,4S,7aS)-7a-methyl-1-[(2R)-4-phenylsulfanylbutan-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)C([C@H](C)CCSc3ccccc3)=CC[C@@H]12 |
| InChI | InChI=1S/C26H42OSSi/c1-6-29(7-2,8-3)27-25-15-12-19-26(5)23(16-17-24(25)26)21(4)18-20-28-22-13-10-9-11-14-22/h9-11,13-14,16,21,24-25H,6-8,12,15,17-20H2,1-5H3/t21-,24+,25+,26-/m1/s1 |
| InChIKey | PMROGXZSIFNRRK-CBRSEMLDSA-N |
| XLogP | 8.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.77 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|