C23H15Br4N3O5S — CID 102131024
5-(2-aminoethylcarbamothioylamino)-2-(2,4,5,7-tetrabromo-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 102131024) has the molecular formula C23H15Br4N3O5S and a molecular weight of 765.07 g/mol. Its IUPAC name is 5-(2-aminoethylcarbamothioylamino)-2-(2,4,5,7-tetrabromo-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-(2-aminoethylcarbamothioylamino)-2-(2,4,5,7-tetrabromo-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 102131024 |
| Molecular Formula | C23H15Br4N3O5S |
| Molecular Weight | 765.07 g/mol |
| Exact Mass | 760.75 |
| IUPAC Name | 5-(2-aminoethylcarbamothioylamino)-2-(2,4,5,7-tetrabromo-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | NCCNC(=S)Nc1ccc(-c2c3cc(Br)c(=O)c(Br)c-3oc3c(Br)c(O)c(Br)cc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H15Br4N3O5S/c24-13-6-11-15(9-2-1-8(5-10(9)22(33)34)30-23(36)29-4-3-28)12-7-14(25)19(32)17(27)21(12)35-20(11)16(26)18(13)31/h1-2,5-7,31H,3-4,28H2,(H,33,34)(H2,29,30,36) |
| InChIKey | MDCCENKGWZABQU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.07 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|