C15H15NO6 — CID 102137641
(3S,5R)-5-[(1R)-1,2-dihydroxyethyl]-3-hydroxy-3-(1H-indol-3-ylmethyl)oxolane-2,4-dione (PubChem CID 102137641) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is (3S,5R)-5-[(1R)-1,2-dihydroxyethyl]-3-hydroxy-3-(1H-indol-3-ylmethyl)oxolane-2,4-dione.
| Compound Name | (3S,5R)-5-[(1R)-1,2-dihydroxyethyl]-3-hydroxy-3-(1H-indol-3-ylmethyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 102137641 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (3S,5R)-5-[(1R)-1,2-dihydroxyethyl]-3-hydroxy-3-(1H-indol-3-ylmethyl)oxolane-2,4-dione |
| SMILES | O=C1O[C@H]([C@H](O)CO)C(=O)[C@@]1(O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H15NO6/c17-7-11(18)12-13(19)15(21,14(20)22-12)5-8-6-16-10-4-2-1-3-9(8)10/h1-4,6,11-12,16-18,21H,5,7H2/t11-,12-,15+/m1/s1 |
| InChIKey | BNQDYEDASYVKFP-JMSVASOKSA-N |
| XLogP | -0.71 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|