C30H30F2N2O8 — CID 102143970
CID 102143970 (PubChem CID 102143970) has the molecular formula C30H30F2N2O8 and a molecular weight of 584.57 g/mol.
| Compound Name | CID 102143970 |
|---|---|
| PubChem CID | 102143970 |
| Molecular Formula | C30H30F2N2O8 |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C1C(C(=O)OC(C)(C)C)C(C(=O)OCC)C2(C(=O)Nc3ccc(F)cc32)C12C(=O)Nc1ccc(F)cc12 |
| InChI | InChI=1S/C30H30F2N2O8/c1-6-40-24(36)21-20(23(35)42-28(3,4)5)22(25(37)41-7-2)30(17-13-15(32)9-11-19(17)34-27(30)39)29(21)16-12-14(31)8-10-18(16)33-26(29)38/h8-13,20-22H,6-7H2,1-5H3,(H,33,38)(H,34,39) |
| InChIKey | XHERWCAEDLPFDI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|