C23H31FN2O5 — CID 130187304
tert-butyl 1-[2-[(3S)-4-ethoxycarbonyl-5-oxopyrrolidin-3-yl]-5-fluorophenyl]piperidine-4-carboxylate (PubChem CID 130187304) has the molecular formula C23H31FN2O5 and a molecular weight of 434.51 g/mol. Its IUPAC name is tert-butyl 1-[2-[(3S)-4-ethoxycarbonyl-5-oxopyrrolidin-3-yl]-5-fluorophenyl]piperidine-4-carboxylate.
| Compound Name | tert-butyl 1-[2-[(3S)-4-ethoxycarbonyl-5-oxopyrrolidin-3-yl]-5-fluorophenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 130187304 |
| Molecular Formula | C23H31FN2O5 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | tert-butyl 1-[2-[(3S)-4-ethoxycarbonyl-5-oxopyrrolidin-3-yl]-5-fluorophenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1C(=O)NC[C@@H]1c1ccc(F)cc1N1CCC(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H31FN2O5/c1-5-30-22(29)19-17(13-25-20(19)27)16-7-6-15(24)12-18(16)26-10-8-14(9-11-26)21(28)31-23(2,3)4/h6-7,12,14,17,19H,5,8-11,13H2,1-4H3,(H,25,27)/t17-,19?/m1/s1 |
| InChIKey | MYCJUCIVVAAMCK-DUSLRRAJSA-N |
| XLogP | 2.78 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|