C11H13NO7 — CID 102147144
(2S,3S)-3-(1,3-dioxolan-2-yl)-1-(furan-2-yl)-2-hydroxy-4-nitrobutan-1-one (PubChem CID 102147144) has the molecular formula C11H13NO7 and a molecular weight of 271.22 g/mol. Its IUPAC name is (2S,3S)-3-(1,3-dioxolan-2-yl)-1-(furan-2-yl)-2-hydroxy-4-nitrobutan-1-one.
| Compound Name | (2S,3S)-3-(1,3-dioxolan-2-yl)-1-(furan-2-yl)-2-hydroxy-4-nitrobutan-1-one |
|---|---|
| PubChem CID | 102147144 |
| Molecular Formula | C11H13NO7 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | (2S,3S)-3-(1,3-dioxolan-2-yl)-1-(furan-2-yl)-2-hydroxy-4-nitrobutan-1-one |
| SMILES | O=C(c1ccco1)[C@@H](O)[C@H](C[N+](=O)[O-])C1OCCO1 |
| InChI | InChI=1S/C11H13NO7/c13-9(10(14)8-2-1-3-17-8)7(6-12(15)16)11-18-4-5-19-11/h1-3,7,9,11,13H,4-6H2/t7-,9-/m0/s1 |
| InChIKey | RAXFWSIUCQJERJ-CBAPKCEASA-N |
| XLogP | 0.09 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|