C14Cl2F8O4S — CID 102147579
4-(4-carbonochloridoyl-2,3,5,6-tetrafluorophenyl)sulfonyl-2,3,5,6-tetrafluorobenzoyl chloride (PubChem CID 102147579) has the molecular formula C14Cl2F8O4S and a molecular weight of 487.11 g/mol. Its IUPAC name is 4-(4-carbonochloridoyl-2,3,5,6-tetrafluorophenyl)sulfonyl-2,3,5,6-tetrafluorobenzoyl chloride.
| Compound Name | 4-(4-carbonochloridoyl-2,3,5,6-tetrafluorophenyl)sulfonyl-2,3,5,6-tetrafluorobenzoyl chloride |
|---|---|
| PubChem CID | 102147579 |
| Molecular Formula | C14Cl2F8O4S |
| Molecular Weight | 487.11 g/mol |
| Exact Mass | 485.88 |
| IUPAC Name | 4-(4-carbonochloridoyl-2,3,5,6-tetrafluorophenyl)sulfonyl-2,3,5,6-tetrafluorobenzoyl chloride |
| SMILES | O=C(Cl)c1c(F)c(F)c(S(=O)(=O)c2c(F)c(F)c(C(=O)Cl)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14Cl2F8O4S/c15-13(25)1-3(17)7(21)11(8(22)4(1)18)29(27,28)12-9(23)5(19)2(14(16)26)6(20)10(12)24 |
| InChIKey | REKVCXFHVOXCKM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.11 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|