C49H98Si9 — CID 102149390
tris[tert-butyl(dimethyl)silyl]-[fluoren-9-ylidene-tris[tert-butyl(dimethyl)silyl]silylsilyl]silane (PubChem CID 102149390) has the molecular formula C49H98Si9 and a molecular weight of 940.10 g/mol. Its IUPAC name is tris[tert-butyl(dimethyl)silyl]-[fluoren-9-ylidene-tris[tert-butyl(dimethyl)silyl]silylsilyl]silane.
| Compound Name | tris[tert-butyl(dimethyl)silyl]-[fluoren-9-ylidene-tris[tert-butyl(dimethyl)silyl]silylsilyl]silane |
|---|---|
| PubChem CID | 102149390 |
| Molecular Formula | C49H98Si9 |
| Molecular Weight | 940.10 g/mol |
| Exact Mass | 938.56 |
| IUPAC Name | tris[tert-butyl(dimethyl)silyl]-[fluoren-9-ylidene-tris[tert-butyl(dimethyl)silyl]silylsilyl]silane |
| SMILES | CC(C)(C)[Si](C)(C)[Si]([Si](=C1c2ccccc2-c2ccccc21)[Si]([Si](C)(C)C(C)(C)C)([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C49H98Si9/c1-44(2,3)51(19,20)57(52(21,22)45(4,5)6,53(23,24)46(7,8)9)50(43-41-37-33-31-35-39(41)40-36-32-34-38-42(40)43)58(54(25,26)47(10,11)12,55(27,28)48(13,14)15)56(29,30)49(16,17)18/h31-38H,1-30H3 |
| InChIKey | NRSLWDSHSDTBBM-UHFFFAOYSA-N |
| XLogP | 16.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.10 |
| LogP ≤ 5 | 16.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|