C18H12Cl2N2O5 — CID 102151423
(2S,3R)-3-(3,4-dichlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-4-nitrobutanal (PubChem CID 102151423) has the molecular formula C18H12Cl2N2O5 and a molecular weight of 407.21 g/mol. Its IUPAC name is (2S,3R)-3-(3,4-dichlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-4-nitrobutanal.
| Compound Name | (2S,3R)-3-(3,4-dichlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-4-nitrobutanal |
|---|---|
| PubChem CID | 102151423 |
| Molecular Formula | C18H12Cl2N2O5 |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | (2S,3R)-3-(3,4-dichlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-4-nitrobutanal |
| SMILES | O=C[C@H]([C@@H](C[N+](=O)[O-])c1ccc(Cl)c(Cl)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H12Cl2N2O5/c19-14-6-5-10(7-15(14)20)13(8-21(26)27)16(9-23)22-17(24)11-3-1-2-4-12(11)18(22)25/h1-7,9,13,16H,8H2/t13-,16+/m0/s1 |
| InChIKey | DPQCOVQPODVRPE-XJKSGUPXSA-N |
| XLogP | 3.22 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|