C13H13NO3 — CID 102161994
(3R,8aS)-3-phenyl-6,7,8,8a-tetrahydro-3H-[1,3]oxazolo[3,2-a]pyridine-2,5-dione (PubChem CID 102161994) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is (3R,8aS)-3-phenyl-6,7,8,8a-tetrahydro-3H-[1,3]oxazolo[3,2-a]pyridine-2,5-dione.
| Compound Name | (3R,8aS)-3-phenyl-6,7,8,8a-tetrahydro-3H-[1,3]oxazolo[3,2-a]pyridine-2,5-dione |
|---|---|
| PubChem CID | 102161994 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (3R,8aS)-3-phenyl-6,7,8,8a-tetrahydro-3H-[1,3]oxazolo[3,2-a]pyridine-2,5-dione |
| SMILES | O=C1O[C@H]2CCCC(=O)N2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H13NO3/c15-10-7-4-8-11-14(10)12(13(16)17-11)9-5-2-1-3-6-9/h1-3,5-6,11-12H,4,7-8H2/t11-,12+/m0/s1 |
| InChIKey | QPGLKELTMAIQTO-NWDGAFQWSA-N |
| XLogP | 1.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |