C24H42F2O4Si — CID 102166927
(2S)-2-[(2R,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5,8-trimethylnon-7-enyl]-3,3-difluoro-2H-pyran-6-one (PubChem CID 102166927) has the molecular formula C24H42F2O4Si and a molecular weight of 460.68 g/mol. Its IUPAC name is (2S)-2-[(2R,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5,8-trimethylnon-7-enyl]-3,3-difluoro-2H-pyran-6-one.
| Compound Name | (2S)-2-[(2R,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5,8-trimethylnon-7-enyl]-3,3-difluoro-2H-pyran-6-one |
|---|---|
| PubChem CID | 102166927 |
| Molecular Formula | C24H42F2O4Si |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | (2S)-2-[(2R,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5,8-trimethylnon-7-enyl]-3,3-difluoro-2H-pyran-6-one |
| SMILES | CO[C@@H]([C@H](C)[C@@H](C[C@@H]1OC(=O)C=CC1(F)F)O[Si](C)(C)C(C)(C)C)[C@@H](C)CC=C(C)C |
| InChI | InChI=1S/C24H42F2O4Si/c1-16(2)11-12-17(3)22(28-8)18(4)19(30-31(9,10)23(5,6)7)15-20-24(25,26)14-13-21(27)29-20/h11,13-14,17-20,22H,12,15H2,1-10H3/t17-,18+,19+,20-,22+/m0/s1 |
| InChIKey | XNNQOIOSZHKDMP-GXQSQTKBSA-N |
| XLogP | 6.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|