C21H23BrNO5P — CID 102172899
(3R,4S)-1-[(2-bromophenyl)methyl]-4-[(E)-2-dimethoxyphosphorylethenyl]-3-phenylmethoxyazetidin-2-one (PubChem CID 102172899) has the molecular formula C21H23BrNO5P and a molecular weight of 480.30 g/mol. Its IUPAC name is (3R,4S)-1-[(2-bromophenyl)methyl]-4-[(E)-2-dimethoxyphosphorylethenyl]-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3R,4S)-1-[(2-bromophenyl)methyl]-4-[(E)-2-dimethoxyphosphorylethenyl]-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 102172899 |
| Molecular Formula | C21H23BrNO5P |
| Molecular Weight | 480.30 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | (3R,4S)-1-[(2-bromophenyl)methyl]-4-[(E)-2-dimethoxyphosphorylethenyl]-3-phenylmethoxyazetidin-2-one |
| SMILES | COP(=O)(/C=C/[C@H]1[C@@H](OCc2ccccc2)C(=O)N1Cc1ccccc1Br)OC |
| InChI | InChI=1S/C21H23BrNO5P/c1-26-29(25,27-2)13-12-19-20(28-15-16-8-4-3-5-9-16)21(24)23(19)14-17-10-6-7-11-18(17)22/h3-13,19-20H,14-15H2,1-2H3/b13-12+/t19-,20+/m0/s1 |
| InChIKey | HIIXPQUEUGPQIY-RXKWHAPPSA-N |
| XLogP | 4.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|